C24H24O4 — CID 101240446
(2S,3R,4R)-2-(trityloxymethyl)oxolane-3,4-diol (PubChem CID 101240446) has the molecular formula C24H24O4 and a molecular weight of 376.45 g/mol. Its IUPAC name is (2S,3R,4R)-2-(trityloxymethyl)oxolane-3,4-diol.
| Compound Name | (2S,3R,4R)-2-(trityloxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 101240446 |
| Molecular Formula | C24H24O4 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | (2S,3R,4R)-2-(trityloxymethyl)oxolane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)CO[C@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H24O4/c25-21-16-27-22(23(21)26)17-28-24(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,21-23,25-26H,16-17H2/t21-,22+,23-/m1/s1 |
| InChIKey | SXZVPFGVXAWSBE-XPWALMASSA-N |
| XLogP | 3.12 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|