C26H28O5 — CID 11811858
(2R,3S,4R,6S)-6-methoxy-2-(trityloxymethyl)oxane-3,4-diol (PubChem CID 11811858) has the molecular formula C26H28O5 and a molecular weight of 420.51 g/mol. Its IUPAC name is (2R,3S,4R,6S)-6-methoxy-2-(trityloxymethyl)oxane-3,4-diol.
| Compound Name | (2R,3S,4R,6S)-6-methoxy-2-(trityloxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 11811858 |
| Molecular Formula | C26H28O5 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | (2R,3S,4R,6S)-6-methoxy-2-(trityloxymethyl)oxane-3,4-diol |
| SMILES | CO[C@@H]1C[C@@H](O)[C@H](O)[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C26H28O5/c1-29-24-17-22(27)25(28)23(31-24)18-30-26(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16,22-25,27-28H,17-18H2,1H3/t22-,23-,24+,25+/m1/s1 |
| InChIKey | FXSGDUKYGQQTFV-NGSHPTGOSA-N |
| XLogP | 3.48 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|