C25H25N3O3 — CID 23251731
(2S,3R)-3-azido-5-methoxy-2-(trityloxymethyl)oxolane (PubChem CID 23251731) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is (2S,3R)-3-azido-5-methoxy-2-(trityloxymethyl)oxolane.
| Compound Name | (2S,3R)-3-azido-5-methoxy-2-(trityloxymethyl)oxolane |
|---|---|
| PubChem CID | 23251731 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | (2S,3R)-3-azido-5-methoxy-2-(trityloxymethyl)oxolane |
| SMILES | COC1C[C@@H](N=[N+]=[N-])[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C25H25N3O3/c1-29-24-17-22(27-28-26)23(31-24)18-30-25(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16,22-24H,17-18H2,1H3/t22-,23-,24?/m1/s1 |
| InChIKey | RQVIIEVILWLASM-YOQGVNIDSA-N |
| XLogP | 5.44 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|