C28H31N3O3Si — CID 11409136
[(2R,3R,6R)-6-azido-2-(trityloxymethyl)-3,6-dihydro-2H-pyran-3-yl]oxy-trimethylsilane (PubChem CID 11409136) has the molecular formula C28H31N3O3Si and a molecular weight of 485.66 g/mol. Its IUPAC name is [(2R,3R,6R)-6-azido-2-(trityloxymethyl)-3,6-dihydro-2H-pyran-3-yl]oxy-trimethylsilane.
| Compound Name | [(2R,3R,6R)-6-azido-2-(trityloxymethyl)-3,6-dihydro-2H-pyran-3-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 11409136 |
| Molecular Formula | C28H31N3O3Si |
| Molecular Weight | 485.66 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | [(2R,3R,6R)-6-azido-2-(trityloxymethyl)-3,6-dihydro-2H-pyran-3-yl]oxy-trimethylsilane |
| SMILES | C[Si](C)(C)O[C@@H]1C=C[C@H](N=[N+]=[N-])O[C@@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H31N3O3Si/c1-35(2,3)34-25-19-20-27(30-31-29)33-26(25)21-32-28(22-13-7-4-8-14-22,23-15-9-5-10-16-23)24-17-11-6-12-18-24/h4-20,25-27H,21H2,1-3H3/t25-,26-,27-/m1/s1 |
| InChIKey | FLZOJBASKIUSSG-ZONZVBGPSA-N |
| XLogP | 6.81 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.66 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|