C33H35N3O9 — CID 90023115
[(2R,3R,4S,5S,6S)-4,5-diacetyloxy-6-(2-azidoethoxy)-2-(trityloxymethyl)oxan-3-yl] acetate (PubChem CID 90023115) has the molecular formula C33H35N3O9 and a molecular weight of 617.66 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-4,5-diacetyloxy-6-(2-azidoethoxy)-2-(trityloxymethyl)oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5S,6S)-4,5-diacetyloxy-6-(2-azidoethoxy)-2-(trityloxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 90023115 |
| Molecular Formula | C33H35N3O9 |
| Molecular Weight | 617.66 g/mol |
| Exact Mass | 617.24 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-4,5-diacetyloxy-6-(2-azidoethoxy)-2-(trityloxymethyl)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@@H](OCCN=[N+]=[N-])O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C33H35N3O9/c1-22(37)42-29-28(45-32(40-20-19-35-36-34)31(44-24(3)39)30(29)43-23(2)38)21-41-33(25-13-7-4-8-14-25,26-15-9-5-10-16-26)27-17-11-6-12-18-27/h4-18,28-32H,19-21H2,1-3H3/t28-,29-,30+,31+,32+/m1/s1 |
| InChIKey | SFZWZTWFASMHNB-KQLGDFJMSA-N |
| XLogP | 4.84 |
| TPSA | 155.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.66 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|