C45H58O10 — CID 57366047
[(2R,3R,4S,5S)-4,5,6-tris(2,2-dimethylpropanoyloxy)-2-(trityloxymethyl)oxan-3-yl] 2,2-dimethylpropanoate (PubChem CID 57366047) has the molecular formula C45H58O10 and a molecular weight of 758.95 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-4,5,6-tris(2,2-dimethylpropanoyloxy)-2-(trityloxymethyl)oxan-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4S,5S)-4,5,6-tris(2,2-dimethylpropanoyloxy)-2-(trityloxymethyl)oxan-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 57366047 |
| Molecular Formula | C45H58O10 |
| Molecular Weight | 758.95 g/mol |
| Exact Mass | 758.40 |
| IUPAC Name | [(2R,3R,4S,5S)-4,5,6-tris(2,2-dimethylpropanoyloxy)-2-(trityloxymethyl)oxan-3-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](OC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)[C@@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C45H58O10/c1-41(2,3)37(46)52-33-32(28-50-45(29-22-16-13-17-23-29,30-24-18-14-19-25-30)31-26-20-15-21-27-31)51-36(55-40(49)44(10,11)12)35(54-39(48)43(7,8)9)34(33)53-38(47)42(4,5)6/h13-27,32-36H,28H2,1-12H3/t32-,33-,34+,35+,36?/m1/s1 |
| InChIKey | GRKGLRZOPBVOSM-AMTMJGOGSA-N |
| XLogP | 8.18 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.95 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|