C45H36O8 — CID 141052027
[(2R,3S,4S)-4,5-dibenzoyloxy-2-(trityloxymethyl)oxolan-3-yl] benzoate (PubChem CID 141052027) has the molecular formula C45H36O8 and a molecular weight of 704.78 g/mol. Its IUPAC name is [(2R,3S,4S)-4,5-dibenzoyloxy-2-(trityloxymethyl)oxolan-3-yl] benzoate.
| Compound Name | [(2R,3S,4S)-4,5-dibenzoyloxy-2-(trityloxymethyl)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 141052027 |
| Molecular Formula | C45H36O8 |
| Molecular Weight | 704.78 g/mol |
| Exact Mass | 704.24 |
| IUPAC Name | [(2R,3S,4S)-4,5-dibenzoyloxy-2-(trityloxymethyl)oxolan-3-yl] benzoate |
| SMILES | O=C(OC1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C45H36O8/c46-41(32-19-7-1-8-20-32)51-39-38(31-49-45(35-25-13-4-14-26-35,36-27-15-5-16-28-36)37-29-17-6-18-30-37)50-44(53-43(48)34-23-11-3-12-24-34)40(39)52-42(47)33-21-9-2-10-22-33/h1-30,38-40,44H,31H2/t38-,39+,40+,44?/m1/s1 |
| InChIKey | NZNMNIOPLFYTHZ-YLZPQUFTSA-N |
| XLogP | 8.03 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.78 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|