C46H38O9 — CID 171124517
[(2S,3R,4S,5R)-4,5-dibenzoyloxy-6-hydroxy-2-(trityloxymethyl)oxan-3-yl] benzoate (PubChem CID 171124517) has the molecular formula C46H38O9 and a molecular weight of 734.80 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-4,5-dibenzoyloxy-6-hydroxy-2-(trityloxymethyl)oxan-3-yl] benzoate.
| Compound Name | [(2S,3R,4S,5R)-4,5-dibenzoyloxy-6-hydroxy-2-(trityloxymethyl)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 171124517 |
| Molecular Formula | C46H38O9 |
| Molecular Weight | 734.80 g/mol |
| Exact Mass | 734.25 |
| IUPAC Name | [(2S,3R,4S,5R)-4,5-dibenzoyloxy-6-hydroxy-2-(trityloxymethyl)oxan-3-yl] benzoate |
| SMILES | O=C(O[C@H]1[C@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)C(O)O[C@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C46H38O9/c47-42(32-19-7-1-8-20-32)53-39-38(31-51-46(35-25-13-4-14-26-35,36-27-15-5-16-28-36)37-29-17-6-18-30-37)52-45(50)41(55-44(49)34-23-11-3-12-24-34)40(39)54-43(48)33-21-9-2-10-22-33/h1-30,38-41,45,50H,31H2/t38-,39+,40-,41+,45?/m0/s1 |
| InChIKey | QXWAVJWYFQQUNG-ADNYBGGJSA-N |
| XLogP | 7.39 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.80 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|