C39H34O8 — CID 171127039
[(2R,3R,4S,5R,6R)-3-benzoyloxy-2,5-dihydroxy-6-(trityloxymethyl)oxan-4-yl] benzoate (PubChem CID 171127039) has the molecular formula C39H34O8 and a molecular weight of 630.69 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3-benzoyloxy-2,5-dihydroxy-6-(trityloxymethyl)oxan-4-yl] benzoate.
| Compound Name | [(2R,3R,4S,5R,6R)-3-benzoyloxy-2,5-dihydroxy-6-(trityloxymethyl)oxan-4-yl] benzoate |
|---|---|
| PubChem CID | 171127039 |
| Molecular Formula | C39H34O8 |
| Molecular Weight | 630.69 g/mol |
| Exact Mass | 630.23 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3-benzoyloxy-2,5-dihydroxy-6-(trityloxymethyl)oxan-4-yl] benzoate |
| SMILES | O=C(O[C@@H]1[C@@H](OC(=O)c2ccccc2)[C@H](O)[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)O[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C39H34O8/c40-33-32(26-44-39(29-20-10-3-11-21-29,30-22-12-4-13-23-30)31-24-14-5-15-25-31)45-38(43)35(47-37(42)28-18-8-2-9-19-28)34(33)46-36(41)27-16-6-1-7-17-27/h1-25,32-35,38,40,43H,26H2/t32-,33-,34+,35-,38-/m1/s1 |
| InChIKey | FGKCKQPNUBOCCR-VMMQVLGMSA-N |
| XLogP | 5.52 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.69 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|