C31H29Cl3O9 — CID 171124699
[(2S,3R,4S,5S,6R)-4,5-bis[(2-chloroacetyl)oxy]-6-hydroxy-2-(trityloxymethyl)oxan-3-yl] 2-chloroacetate (PubChem CID 171124699) has the molecular formula C31H29Cl3O9 and a molecular weight of 651.92 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-4,5-bis[(2-chloroacetyl)oxy]-6-hydroxy-2-(trityloxymethyl)oxan-3-yl] 2-chloroacetate.
| Compound Name | [(2S,3R,4S,5S,6R)-4,5-bis[(2-chloroacetyl)oxy]-6-hydroxy-2-(trityloxymethyl)oxan-3-yl] 2-chloroacetate |
|---|---|
| PubChem CID | 171124699 |
| Molecular Formula | C31H29Cl3O9 |
| Molecular Weight | 651.92 g/mol |
| Exact Mass | 650.09 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-4,5-bis[(2-chloroacetyl)oxy]-6-hydroxy-2-(trityloxymethyl)oxan-3-yl] 2-chloroacetate |
| SMILES | O=C(CCl)O[C@@H]1[C@H](OC(=O)CCl)[C@H](O)O[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]1OC(=O)CCl |
| InChI | InChI=1S/C31H29Cl3O9/c32-16-24(35)41-27-23(40-30(38)29(43-26(37)18-34)28(27)42-25(36)17-33)19-39-31(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-15,23,27-30,38H,16-19H2/t23-,27+,28-,29-,30+/m0/s1 |
| InChIKey | VFNCIUPFICQICN-GRMZWMCQSA-N |
| XLogP | 4.16 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.92 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|