C41H40O7 — CID 171122090
[2-hydroxy-4,5-bis(phenylmethoxy)-6-(trityloxymethyl)oxan-3-yl] acetate (PubChem CID 171122090) has the molecular formula C41H40O7 and a molecular weight of 644.76 g/mol. Its IUPAC name is [2-hydroxy-4,5-bis(phenylmethoxy)-6-(trityloxymethyl)oxan-3-yl] acetate.
| Compound Name | [2-hydroxy-4,5-bis(phenylmethoxy)-6-(trityloxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 171122090 |
| Molecular Formula | C41H40O7 |
| Molecular Weight | 644.76 g/mol |
| Exact Mass | 644.28 |
| IUPAC Name | [2-hydroxy-4,5-bis(phenylmethoxy)-6-(trityloxymethyl)oxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(O)OC(COC(c2ccccc2)(c2ccccc2)c2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C41H40O7/c1-30(42)47-39-38(45-28-32-19-9-3-10-20-32)37(44-27-31-17-7-2-8-18-31)36(48-40(39)43)29-46-41(33-21-11-4-12-22-33,34-23-13-5-14-24-34)35-25-15-6-16-26-35/h2-26,36-40,43H,27-29H2,1H3 |
| InChIKey | NILZEHAQOVVJLS-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.76 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|