C39H38O5 — CID 71530577
(4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(trityloxymethyl)oxan-2-ol (PubChem CID 71530577) has the molecular formula C39H38O5 and a molecular weight of 586.73 g/mol. Its IUPAC name is (4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(trityloxymethyl)oxan-2-ol.
| Compound Name | (4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(trityloxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 71530577 |
| Molecular Formula | C39H38O5 |
| Molecular Weight | 586.73 g/mol |
| Exact Mass | 586.27 |
| IUPAC Name | (4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(trityloxymethyl)oxan-2-ol |
| SMILES | OC1C[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C39H38O5/c40-37-26-35(41-27-30-16-6-1-7-17-30)38(42-28-31-18-8-2-9-19-31)36(44-37)29-43-39(32-20-10-3-11-21-32,33-22-12-4-13-23-33)34-24-14-5-15-25-34/h1-25,35-38,40H,26-29H2/t35-,36-,37?,38+/m1/s1 |
| InChIKey | QBVVFMPYOLWKHE-HKKBOHPISA-N |
| XLogP | 7.27 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.73 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|