C39H38O7S — CID 171125987
[(2R,3S,4S,6R)-6-hydroxy-4-phenylmethoxy-2-(trityloxymethyl)oxan-3-yl] 4-methylbenzenesulfonate (PubChem CID 171125987) has the molecular formula C39H38O7S and a molecular weight of 650.79 g/mol. Its IUPAC name is [(2R,3S,4S,6R)-6-hydroxy-4-phenylmethoxy-2-(trityloxymethyl)oxan-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S,4S,6R)-6-hydroxy-4-phenylmethoxy-2-(trityloxymethyl)oxan-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 171125987 |
| Molecular Formula | C39H38O7S |
| Molecular Weight | 650.79 g/mol |
| Exact Mass | 650.23 |
| IUPAC Name | [(2R,3S,4S,6R)-6-hydroxy-4-phenylmethoxy-2-(trityloxymethyl)oxan-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2[C@@H](OCc3ccccc3)C[C@H](O)O[C@@H]2COC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C39H38O7S/c1-29-22-24-34(25-23-29)47(41,42)46-38-35(43-27-30-14-6-2-7-15-30)26-37(40)45-36(38)28-44-39(31-16-8-3-9-17-31,32-18-10-4-11-19-32)33-20-12-5-13-21-33/h2-25,35-38,40H,26-28H2,1H3/t35-,36+,37+,38-/m0/s1 |
| InChIKey | ICGGOKSXQSXUTP-LQDUMDOSSA-N |
| XLogP | 6.77 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.79 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|