C53H50O5S — CID 153310906
(2S,4S,5S)-2-(4-methylphenyl)sulfanyl-3,4,5-tris(phenylmethoxy)-6-(trityloxymethyl)oxane (PubChem CID 153310906) has the molecular formula C53H50O5S and a molecular weight of 799.05 g/mol. Its IUPAC name is (2S,4S,5S)-2-(4-methylphenyl)sulfanyl-3,4,5-tris(phenylmethoxy)-6-(trityloxymethyl)oxane.
| Compound Name | (2S,4S,5S)-2-(4-methylphenyl)sulfanyl-3,4,5-tris(phenylmethoxy)-6-(trityloxymethyl)oxane |
|---|---|
| PubChem CID | 153310906 |
| Molecular Formula | C53H50O5S |
| Molecular Weight | 799.05 g/mol |
| Exact Mass | 798.34 |
| IUPAC Name | (2S,4S,5S)-2-(4-methylphenyl)sulfanyl-3,4,5-tris(phenylmethoxy)-6-(trityloxymethyl)oxane |
| SMILES | Cc1ccc(S[C@@H]2OC(COC(c3ccccc3)(c3ccccc3)c3ccccc3)[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)C2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C53H50O5S/c1-40-32-34-47(35-33-40)59-52-51(56-38-43-24-12-4-13-25-43)50(55-37-42-22-10-3-11-23-42)49(54-36-41-20-8-2-9-21-41)48(58-52)39-57-53(44-26-14-5-15-27-44,45-28-16-6-17-29-45)46-30-18-7-19-31-46/h2-35,48-52H,36-39H2,1H3/t48?,49-,50-,51?,52-/m0/s1 |
| InChIKey | FCYVJFVSYACVMU-AQVGXITBSA-N |
| XLogP | 11.58 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.05 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|