C36H38O5S — CID 101358593
(2R,3S,4S,5R,6R)-3-ethenoxy-2-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 101358593) has the molecular formula C36H38O5S and a molecular weight of 582.76 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-3-ethenoxy-2-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2R,3S,4S,5R,6R)-3-ethenoxy-2-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 101358593 |
| Molecular Formula | C36H38O5S |
| Molecular Weight | 582.76 g/mol |
| Exact Mass | 582.24 |
| IUPAC Name | (2R,3S,4S,5R,6R)-3-ethenoxy-2-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | C=CO[C@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[C@@H]1Sc1ccc(C)cc1 |
| InChI | InChI=1S/C36H38O5S/c1-3-38-35-34(40-25-30-17-11-6-12-18-30)33(39-24-29-15-9-5-10-16-29)32(26-37-23-28-13-7-4-8-14-28)41-36(35)42-31-21-19-27(2)20-22-31/h3-22,32-36H,1,23-26H2,2H3/t32-,33-,34+,35+,36-/m1/s1 |
| InChIKey | QBKJLFSPGFADQJ-DQROVBKRSA-N |
| XLogP | 7.73 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.76 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|