C44H42O5S — CID 10963493
(3S,4S,5R,6R)-2-naphthalen-2-ylsulfanyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 10963493) has the molecular formula C44H42O5S and a molecular weight of 682.88 g/mol. Its IUPAC name is (3S,4S,5R,6R)-2-naphthalen-2-ylsulfanyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (3S,4S,5R,6R)-2-naphthalen-2-ylsulfanyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 10963493 |
| Molecular Formula | C44H42O5S |
| Molecular Weight | 682.88 g/mol |
| Exact Mass | 682.28 |
| IUPAC Name | (3S,4S,5R,6R)-2-naphthalen-2-ylsulfanyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | c1ccc(COC[C@H]2OC(Sc3ccc4ccccc4c3)[C@@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C44H42O5S/c1-5-15-33(16-6-1)28-45-32-40-41(46-29-34-17-7-2-8-18-34)42(47-30-35-19-9-3-10-20-35)43(48-31-36-21-11-4-12-22-36)44(49-40)50-39-26-25-37-23-13-14-24-38(37)27-39/h1-27,40-44H,28-32H2/t40-,41-,42+,43+,44?/m1/s1 |
| InChIKey | ZIZLACILQALSBG-RFIRKHDOSA-N |
| XLogP | 9.63 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.88 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |