C39H38O6S — CID 25194068
[(2S,3S,4R,5R,6R)-3-(naphthalen-2-ylmethoxy)-4,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methyl acetate (PubChem CID 25194068) has the molecular formula C39H38O6S and a molecular weight of 634.79 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6R)-3-(naphthalen-2-ylmethoxy)-4,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4R,5R,6R)-3-(naphthalen-2-ylmethoxy)-4,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 25194068 |
| Molecular Formula | C39H38O6S |
| Molecular Weight | 634.79 g/mol |
| Exact Mass | 634.24 |
| IUPAC Name | [(2S,3S,4R,5R,6R)-3-(naphthalen-2-ylmethoxy)-4,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@H](Sc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C39H38O6S/c1-28(40)41-27-35-36(42-26-31-21-22-32-17-11-12-18-33(32)23-31)37(43-24-29-13-5-2-6-14-29)38(44-25-30-15-7-3-8-16-30)39(45-35)46-34-19-9-4-10-20-34/h2-23,35-39H,24-27H2,1H3/t35-,36-,37+,38+,39+/m0/s1 |
| InChIKey | SYVWNLSXDVAKSL-VEJIKZNJSA-N |
| XLogP | 7.98 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.79 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |