C35H38O6S — CID 71579034
[(2R,3R,4S,5R,6S)-6-ethylsulfanyl-4-(naphthalen-2-ylmethoxy)-3,5-bis(phenylmethoxy)oxan-2-yl]methyl acetate (PubChem CID 71579034) has the molecular formula C35H38O6S and a molecular weight of 586.75 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-6-ethylsulfanyl-4-(naphthalen-2-ylmethoxy)-3,5-bis(phenylmethoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-6-ethylsulfanyl-4-(naphthalen-2-ylmethoxy)-3,5-bis(phenylmethoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71579034 |
| Molecular Formula | C35H38O6S |
| Molecular Weight | 586.75 g/mol |
| Exact Mass | 586.24 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-6-ethylsulfanyl-4-(naphthalen-2-ylmethoxy)-3,5-bis(phenylmethoxy)oxan-2-yl]methyl acetate |
| SMILES | CCS[C@@H]1O[C@H](COC(C)=O)[C@@H](OCc2ccccc2)[C@H](OCc2ccc3ccccc3c2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H38O6S/c1-3-42-35-34(40-22-27-14-8-5-9-15-27)33(39-23-28-18-19-29-16-10-11-17-30(29)20-28)32(31(41-35)24-37-25(2)36)38-21-26-12-6-4-7-13-26/h4-20,31-35H,3,21-24H2,1-2H3/t31-,32-,33+,34-,35+/m1/s1 |
| InChIKey | NVYFWUHTMBFWGH-KJQSSVQNSA-N |
| XLogP | 6.94 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.75 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |