C32H36O8S — CID 11444611
3-[[(2R,3R,4S,5S,6R)-6-ethylsulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-3-oxopropanoic acid (PubChem CID 11444611) has the molecular formula C32H36O8S and a molecular weight of 580.70 g/mol. Its IUPAC name is 3-[[(2R,3R,4S,5S,6R)-6-ethylsulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-3-oxopropanoic acid.
| Compound Name | 3-[[(2R,3R,4S,5S,6R)-6-ethylsulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 11444611 |
| Molecular Formula | C32H36O8S |
| Molecular Weight | 580.70 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | 3-[[(2R,3R,4S,5S,6R)-6-ethylsulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-3-oxopropanoic acid |
| SMILES | CCS[C@H]1O[C@H](COC(=O)CC(=O)O)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C32H36O8S/c1-2-41-32-31(39-21-25-16-10-5-11-17-25)30(38-20-24-14-8-4-9-15-24)29(37-19-23-12-6-3-7-13-23)26(40-32)22-36-28(35)18-27(33)34/h3-17,26,29-32H,2,18-22H2,1H3,(H,33,34)/t26-,29-,30+,31+,32-/m1/s1 |
| InChIKey | KGNBBYBCXLYYIX-GIMGQEMRSA-N |
| XLogP | 5.24 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.70 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|