C24H30O6S — CID 10789545
methyl (2S,3S,4S,5R,6S)-6-ethylsulfanyl-3-methoxy-4,5-bis(phenylmethoxy)oxane-2-carboxylate (PubChem CID 10789545) has the molecular formula C24H30O6S and a molecular weight of 446.57 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-6-ethylsulfanyl-3-methoxy-4,5-bis(phenylmethoxy)oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-6-ethylsulfanyl-3-methoxy-4,5-bis(phenylmethoxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 10789545 |
| Molecular Formula | C24H30O6S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-6-ethylsulfanyl-3-methoxy-4,5-bis(phenylmethoxy)oxane-2-carboxylate |
| SMILES | CCS[C@@H]1O[C@H](C(=O)OC)[C@@H](OC)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C24H30O6S/c1-4-31-24-22(29-16-18-13-9-6-10-14-18)20(28-15-17-11-7-5-8-12-17)19(26-2)21(30-24)23(25)27-3/h5-14,19-22,24H,4,15-16H2,1-3H3/t19-,20-,21-,22+,24-/m0/s1 |
| InChIKey | SHTWBXLCHSOBII-CHSSDKTLSA-N |
| XLogP | 3.82 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |