C18H28O5S — CID 102377923
(2S,3R,4S,5R,6R)-2-ethylsulfanyl-3,4,5-trimethoxy-6-(phenylmethoxymethyl)oxane (PubChem CID 102377923) has the molecular formula C18H28O5S and a molecular weight of 356.48 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-ethylsulfanyl-3,4,5-trimethoxy-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2S,3R,4S,5R,6R)-2-ethylsulfanyl-3,4,5-trimethoxy-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 102377923 |
| Molecular Formula | C18H28O5S |
| Molecular Weight | 356.48 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-ethylsulfanyl-3,4,5-trimethoxy-6-(phenylmethoxymethyl)oxane |
| SMILES | CCS[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OC)[C@H](OC)[C@H]1OC |
| InChI | InChI=1S/C18H28O5S/c1-5-24-18-17(21-4)16(20-3)15(19-2)14(23-18)12-22-11-13-9-7-6-8-10-13/h6-10,14-18H,5,11-12H2,1-4H3/t14-,15-,16+,17-,18+/m1/s1 |
| InChIKey | PHOGFGCPLHOLNK-SFFUCWETSA-N |
| XLogP | 2.73 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |