C23H30O4S — CID 101480240
(2S,3R,4R,5S,6S)-2-ethylsulfanyl-3-methoxy-6-methyl-4,5-bis(phenylmethoxy)oxane (PubChem CID 101480240) has the molecular formula C23H30O4S and a molecular weight of 402.56 g/mol. Its IUPAC name is (2S,3R,4R,5S,6S)-2-ethylsulfanyl-3-methoxy-6-methyl-4,5-bis(phenylmethoxy)oxane.
| Compound Name | (2S,3R,4R,5S,6S)-2-ethylsulfanyl-3-methoxy-6-methyl-4,5-bis(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 101480240 |
| Molecular Formula | C23H30O4S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | (2S,3R,4R,5S,6S)-2-ethylsulfanyl-3-methoxy-6-methyl-4,5-bis(phenylmethoxy)oxane |
| SMILES | CCS[C@@H]1O[C@@H](C)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OC |
| InChI | InChI=1S/C23H30O4S/c1-4-28-23-22(24-3)21(26-16-19-13-9-6-10-14-19)20(17(2)27-23)25-15-18-11-7-5-8-12-18/h5-14,17,20-23H,4,15-16H2,1-3H3/t17-,20-,21+,22+,23-/m0/s1 |
| InChIKey | HXBSGIHHFDRBRI-GIFBIUIXSA-N |
| XLogP | 4.67 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |