C24H33NO3S — CID 67153035
(3R,4S,5S,6R)-2-ethylsulfanyl-N,N,6-trimethyl-3,5-bis(phenylmethoxy)oxan-4-amine (PubChem CID 67153035) has the molecular formula C24H33NO3S and a molecular weight of 415.60 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2-ethylsulfanyl-N,N,6-trimethyl-3,5-bis(phenylmethoxy)oxan-4-amine.
| Compound Name | (3R,4S,5S,6R)-2-ethylsulfanyl-N,N,6-trimethyl-3,5-bis(phenylmethoxy)oxan-4-amine |
|---|---|
| PubChem CID | 67153035 |
| Molecular Formula | C24H33NO3S |
| Molecular Weight | 415.60 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | (3R,4S,5S,6R)-2-ethylsulfanyl-N,N,6-trimethyl-3,5-bis(phenylmethoxy)oxan-4-amine |
| SMILES | CCSC1O[C@H](C)[C@@H](OCc2ccccc2)[C@H](N(C)C)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C24H33NO3S/c1-5-29-24-23(27-17-20-14-10-7-11-15-20)21(25(3)4)22(18(2)28-24)26-16-19-12-8-6-9-13-19/h6-15,18,21-24H,5,16-17H2,1-4H3/t18-,21+,22-,23-,24?/m1/s1 |
| InChIKey | FRJUUIARROOJDT-PSCSGYEASA-N |
| XLogP | 4.59 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.60 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |