C29H31Cl3O4S — CID 15929758
(2R,3S,4R,5R,6S)-3,4,5-tris[(4-chlorophenyl)methoxy]-2-ethylsulfanyl-6-methyloxane (PubChem CID 15929758) has the molecular formula C29H31Cl3O4S and a molecular weight of 581.99 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-3,4,5-tris[(4-chlorophenyl)methoxy]-2-ethylsulfanyl-6-methyloxane.
| Compound Name | (2R,3S,4R,5R,6S)-3,4,5-tris[(4-chlorophenyl)methoxy]-2-ethylsulfanyl-6-methyloxane |
|---|---|
| PubChem CID | 15929758 |
| Molecular Formula | C29H31Cl3O4S |
| Molecular Weight | 581.99 g/mol |
| Exact Mass | 580.10 |
| IUPAC Name | (2R,3S,4R,5R,6S)-3,4,5-tris[(4-chlorophenyl)methoxy]-2-ethylsulfanyl-6-methyloxane |
| SMILES | CCS[C@H]1O[C@@H](C)[C@@H](OCc2ccc(Cl)cc2)[C@@H](OCc2ccc(Cl)cc2)[C@@H]1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H31Cl3O4S/c1-3-37-29-28(35-18-22-8-14-25(32)15-9-22)27(34-17-21-6-12-24(31)13-7-21)26(19(2)36-29)33-16-20-4-10-23(30)11-5-20/h4-15,19,26-29H,3,16-18H2,1-2H3/t19-,26+,27+,28-,29+/m0/s1 |
| InChIKey | OHAJLAAHJQHJEK-HLNUBMOZSA-N |
| XLogP | 8.20 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.99 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |