C36H37ClO7S — CID 11308252
(4-chlorophenyl) [(2S,3R,4S,5R,6R)-2-ethylsulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] carbonate (PubChem CID 11308252) has the molecular formula C36H37ClO7S and a molecular weight of 649.21 g/mol. Its IUPAC name is (4-chlorophenyl) [(2S,3R,4S,5R,6R)-2-ethylsulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] carbonate.
| Compound Name | (4-chlorophenyl) [(2S,3R,4S,5R,6R)-2-ethylsulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] carbonate |
|---|---|
| PubChem CID | 11308252 |
| Molecular Formula | C36H37ClO7S |
| Molecular Weight | 649.21 g/mol |
| Exact Mass | 648.19 |
| IUPAC Name | (4-chlorophenyl) [(2S,3R,4S,5R,6R)-2-ethylsulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl] carbonate |
| SMILES | CCS[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OC(=O)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C36H37ClO7S/c1-2-45-35-34(44-36(38)42-30-20-18-29(37)19-21-30)33(41-24-28-16-10-5-11-17-28)32(40-23-27-14-8-4-9-15-27)31(43-35)25-39-22-26-12-6-3-7-13-26/h3-21,31-35H,2,22-25H2,1H3/t31-,32-,33+,34-,35+/m1/s1 |
| InChIKey | LFZNBADXTILDFB-KJQSSVQNSA-N |
| XLogP | 8.09 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.21 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|