C32H38O5S — CID 122376699
(2S,3R,4S,5S,6R)-2-ethylsulfanyl-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-4-prop-2-enoxyoxane (PubChem CID 122376699) has the molecular formula C32H38O5S and a molecular weight of 534.72 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-ethylsulfanyl-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-4-prop-2-enoxyoxane.
| Compound Name | (2S,3R,4S,5S,6R)-2-ethylsulfanyl-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-4-prop-2-enoxyoxane |
|---|---|
| PubChem CID | 122376699 |
| Molecular Formula | C32H38O5S |
| Molecular Weight | 534.72 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-ethylsulfanyl-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-4-prop-2-enoxyoxane |
| SMILES | C=CCO[C@H]1[C@@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[C@@H](SCC)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C32H38O5S/c1-3-20-34-30-29(35-22-26-16-10-6-11-17-26)28(24-33-21-25-14-8-5-9-15-25)37-32(38-4-2)31(30)36-23-27-18-12-7-13-19-27/h3,5-19,28-32H,1,4,20-24H2,2H3/t28-,29+,30+,31-,32+/m1/s1 |
| InChIKey | BUZJINPJRPIXLF-MQSWGENCSA-N |
| XLogP | 6.42 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.72 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|