C26H27ClN2O5S2 — CID 11706610
[(2S,3R,4R,5S,6R)-5-[(4-chlorophenyl)methoxy]-6-ethylsulfanyl-4-(imidazole-1-carbothioyloxy)-2-methyloxan-3-yl] benzoate (PubChem CID 11706610) has the molecular formula C26H27ClN2O5S2 and a molecular weight of 547.10 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6R)-5-[(4-chlorophenyl)methoxy]-6-ethylsulfanyl-4-(imidazole-1-carbothioyloxy)-2-methyloxan-3-yl] benzoate.
| Compound Name | [(2S,3R,4R,5S,6R)-5-[(4-chlorophenyl)methoxy]-6-ethylsulfanyl-4-(imidazole-1-carbothioyloxy)-2-methyloxan-3-yl] benzoate |
|---|---|
| PubChem CID | 11706610 |
| Molecular Formula | C26H27ClN2O5S2 |
| Molecular Weight | 547.10 g/mol |
| Exact Mass | 546.10 |
| IUPAC Name | [(2S,3R,4R,5S,6R)-5-[(4-chlorophenyl)methoxy]-6-ethylsulfanyl-4-(imidazole-1-carbothioyloxy)-2-methyloxan-3-yl] benzoate |
| SMILES | CCS[C@H]1O[C@@H](C)[C@@H](OC(=O)c2ccccc2)[C@@H](OC(=S)n2ccnc2)[C@@H]1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H27ClN2O5S2/c1-3-36-25-23(31-15-18-9-11-20(27)12-10-18)22(34-26(35)29-14-13-28-16-29)21(17(2)32-25)33-24(30)19-7-5-4-6-8-19/h4-14,16-17,21-23,25H,3,15H2,1-2H3/t17-,21+,22+,23-,25+/m0/s1 |
| InChIKey | WTXHVLWVBBQWJZ-ZUKMYBLTSA-N |
| XLogP | 5.36 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.10 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|