C30H28O9S — CID 131700496
methyl (3S,6S)-3,4,5-tribenzoyloxy-6-ethylsulfanyloxane-2-carboxylate (PubChem CID 131700496) has the molecular formula C30H28O9S and a molecular weight of 564.61 g/mol. Its IUPAC name is methyl (3S,6S)-3,4,5-tribenzoyloxy-6-ethylsulfanyloxane-2-carboxylate.
| Compound Name | methyl (3S,6S)-3,4,5-tribenzoyloxy-6-ethylsulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 131700496 |
| Molecular Formula | C30H28O9S |
| Molecular Weight | 564.61 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | methyl (3S,6S)-3,4,5-tribenzoyloxy-6-ethylsulfanyloxane-2-carboxylate |
| SMILES | CCS[C@@H]1OC(C(=O)OC)[C@@H](OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H28O9S/c1-3-40-30-25(38-28(33)21-17-11-6-12-18-21)23(37-27(32)20-15-9-5-10-16-20)22(24(39-30)29(34)35-2)36-26(31)19-13-7-4-8-14-19/h4-18,22-25,30H,3H2,1-2H3/t22-,23?,24?,25?,30-/m0/s1 |
| InChIKey | SIKVBXANIMEERD-KTAZTBJCSA-N |
| XLogP | 4.31 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.61 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|