C30H30O7S — CID 126497699
[(3R,4S,6S)-3,5-dibenzoyloxy-6-ethylsulfanyl-4-methyloxan-2-yl]methyl benzoate (PubChem CID 126497699) has the molecular formula C30H30O7S and a molecular weight of 534.63 g/mol. Its IUPAC name is [(3R,4S,6S)-3,5-dibenzoyloxy-6-ethylsulfanyl-4-methyloxan-2-yl]methyl benzoate.
| Compound Name | [(3R,4S,6S)-3,5-dibenzoyloxy-6-ethylsulfanyl-4-methyloxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 126497699 |
| Molecular Formula | C30H30O7S |
| Molecular Weight | 534.63 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | [(3R,4S,6S)-3,5-dibenzoyloxy-6-ethylsulfanyl-4-methyloxan-2-yl]methyl benzoate |
| SMILES | CCS[C@@H]1OC(COC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H](C)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H30O7S/c1-3-38-30-26(37-29(33)23-17-11-6-12-18-23)20(2)25(36-28(32)22-15-9-5-10-16-22)24(35-30)19-34-27(31)21-13-7-4-8-14-21/h4-18,20,24-26,30H,3,19H2,1-2H3/t20-,24?,25+,26?,30-/m0/s1 |
| InChIKey | JSXXGKCNTOVGNZ-FADRXUBYSA-N |
| XLogP | 5.41 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.63 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|