C18H26O3S — CID 118241367
[(3S,4S,6S)-6-ethylsulfanyl-3,4,5-trimethyloxan-2-yl]methyl benzoate (PubChem CID 118241367) has the molecular formula C18H26O3S and a molecular weight of 322.47 g/mol. Its IUPAC name is [(3S,4S,6S)-6-ethylsulfanyl-3,4,5-trimethyloxan-2-yl]methyl benzoate.
| Compound Name | [(3S,4S,6S)-6-ethylsulfanyl-3,4,5-trimethyloxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 118241367 |
| Molecular Formula | C18H26O3S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | [(3S,4S,6S)-6-ethylsulfanyl-3,4,5-trimethyloxan-2-yl]methyl benzoate |
| SMILES | CCS[C@@H]1OC(COC(=O)c2ccccc2)[C@@H](C)[C@H](C)C1C |
| InChI | InChI=1S/C18H26O3S/c1-5-22-18-14(4)12(2)13(3)16(21-18)11-20-17(19)15-9-7-6-8-10-15/h6-10,12-14,16,18H,5,11H2,1-4H3/t12-,13-,14?,16?,18-/m0/s1 |
| InChIKey | DNVJHLDUMZWVEQ-SVTQDCBWSA-N |
| XLogP | 4.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |