C30H36O9S — CID 10578993
[(1S,3R,4R,6R,7S,8S,10S)-7-benzoyloxy-6-ethylsulfanyl-1,10-dimethoxy-2,5,9-trioxatricyclo[8.4.0.03,8]tetradecan-4-yl]methyl benzoate (PubChem CID 10578993) has the molecular formula C30H36O9S and a molecular weight of 572.68 g/mol. Its IUPAC name is [(1S,3R,4R,6R,7S,8S,10S)-7-benzoyloxy-6-ethylsulfanyl-1,10-dimethoxy-2,5,9-trioxatricyclo[8.4.0.03,8]tetradecan-4-yl]methyl benzoate.
| Compound Name | [(1S,3R,4R,6R,7S,8S,10S)-7-benzoyloxy-6-ethylsulfanyl-1,10-dimethoxy-2,5,9-trioxatricyclo[8.4.0.03,8]tetradecan-4-yl]methyl benzoate |
|---|---|
| PubChem CID | 10578993 |
| Molecular Formula | C30H36O9S |
| Molecular Weight | 572.68 g/mol |
| Exact Mass | 572.21 |
| IUPAC Name | [(1S,3R,4R,6R,7S,8S,10S)-7-benzoyloxy-6-ethylsulfanyl-1,10-dimethoxy-2,5,9-trioxatricyclo[8.4.0.03,8]tetradecan-4-yl]methyl benzoate |
| SMILES | CCS[C@H]1O[C@H](COC(=O)c2ccccc2)[C@H]2O[C@@]3(OC)CCCC[C@]3(OC)O[C@@H]2[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H36O9S/c1-4-40-28-25(37-27(32)21-15-9-6-10-16-21)24-23(22(36-28)19-35-26(31)20-13-7-5-8-14-20)38-29(33-2)17-11-12-18-30(29,34-3)39-24/h5-10,13-16,22-25,28H,4,11-12,17-19H2,1-3H3/t22-,23-,24+,25+,28-,29+,30+/m1/s1 |
| InChIKey | KUJKXBJPIDCXAR-MNSNFRGTSA-N |
| XLogP | 4.59 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.68 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |