C37H32O9S — CID 169247052
[(2R,3S,4S,5R,6R)-3,4,5-tribenzoyloxy-6-prop-2-enylsulfanyloxan-2-yl]methyl benzoate (PubChem CID 169247052) has the molecular formula C37H32O9S and a molecular weight of 652.72 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-tribenzoyloxy-6-prop-2-enylsulfanyloxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-tribenzoyloxy-6-prop-2-enylsulfanyloxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 169247052 |
| Molecular Formula | C37H32O9S |
| Molecular Weight | 652.72 g/mol |
| Exact Mass | 652.18 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-tribenzoyloxy-6-prop-2-enylsulfanyloxan-2-yl]methyl benzoate |
| SMILES | C=CCS[C@H]1O[C@H](COC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C37H32O9S/c1-2-23-47-37-32(46-36(41)28-21-13-6-14-22-28)31(45-35(40)27-19-11-5-12-20-27)30(44-34(39)26-17-9-4-10-18-26)29(43-37)24-42-33(38)25-15-7-3-8-16-25/h2-22,29-32,37H,1,23-24H2/t29-,30+,31+,32-,37-/m1/s1 |
| InChIKey | WUHQMSQBRZRFJV-UWTXSIQYSA-N |
| XLogP | 6.16 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.72 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|