C38H36O9S — CID 570155
(3,4,5-tribenzoyloxy-6-tert-butylsulfanyloxan-2-yl)methyl benzoate (PubChem CID 570155) has the molecular formula C38H36O9S and a molecular weight of 668.76 g/mol. Its IUPAC name is (3,4,5-tribenzoyloxy-6-tert-butylsulfanyloxan-2-yl)methyl benzoate.
| Compound Name | (3,4,5-tribenzoyloxy-6-tert-butylsulfanyloxan-2-yl)methyl benzoate |
|---|---|
| PubChem CID | 570155 |
| Molecular Formula | C38H36O9S |
| Molecular Weight | 668.76 g/mol |
| Exact Mass | 668.21 |
| IUPAC Name | (3,4,5-tribenzoyloxy-6-tert-butylsulfanyloxan-2-yl)methyl benzoate |
| SMILES | CC(C)(C)SC1OC(COC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C38H36O9S/c1-38(2,3)48-37-32(47-36(42)28-22-14-7-15-23-28)31(46-35(41)27-20-12-6-13-21-27)30(45-34(40)26-18-10-5-11-19-26)29(44-37)24-43-33(39)25-16-8-4-9-17-25/h4-23,29-32,37H,24H2,1-3H3 |
| InChIKey | QVKMBIALMIUWCF-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.76 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|