C27H24N2O7S — CID 13470517
[(2R,3R,4R,5S)-3,4-dibenzoyloxy-5-carbamimidoylsulfanyloxolan-2-yl]methyl benzoate (PubChem CID 13470517) has the molecular formula C27H24N2O7S and a molecular weight of 520.56 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-3,4-dibenzoyloxy-5-carbamimidoylsulfanyloxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5S)-3,4-dibenzoyloxy-5-carbamimidoylsulfanyloxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 13470517 |
| Molecular Formula | C27H24N2O7S |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.13 |
| IUPAC Name | [(2R,3R,4R,5S)-3,4-dibenzoyloxy-5-carbamimidoylsulfanyloxolan-2-yl]methyl benzoate |
| SMILES | [H]/N=C(\N)S[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H24N2O7S/c28-27(29)37-26-22(36-25(32)19-14-8-3-9-15-19)21(35-24(31)18-12-6-2-7-13-18)20(34-26)16-33-23(30)17-10-4-1-5-11-17/h1-15,20-22,26H,16H2,(H3,28,29)/t20-,21-,22-,26+/m1/s1 |
| InChIKey | ICQFZYRQTAHVTL-BILGYAHESA-N |
| XLogP | 3.65 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|