C36H31NO10 — CID 59841446
(3,4,5-tribenzoyloxy-6-ethanimidoyloxyoxan-2-yl)methyl benzoate (PubChem CID 59841446) has the molecular formula C36H31NO10 and a molecular weight of 637.64 g/mol. Its IUPAC name is (3,4,5-tribenzoyloxy-6-ethanimidoyloxyoxan-2-yl)methyl benzoate.
| Compound Name | (3,4,5-tribenzoyloxy-6-ethanimidoyloxyoxan-2-yl)methyl benzoate |
|---|---|
| PubChem CID | 59841446 |
| Molecular Formula | C36H31NO10 |
| Molecular Weight | 637.64 g/mol |
| Exact Mass | 637.19 |
| IUPAC Name | (3,4,5-tribenzoyloxy-6-ethanimidoyloxyoxan-2-yl)methyl benzoate |
| SMILES | [H]/N=C(\C)OC1OC(COC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C36H31NO10/c1-23(37)43-36-31(47-35(41)27-20-12-5-13-21-27)30(46-34(40)26-18-10-4-11-19-26)29(45-33(39)25-16-8-3-9-17-25)28(44-36)22-42-32(38)24-14-6-2-7-15-24/h2-21,28-31,36-37H,22H2,1H3/b37-23+ |
| InChIKey | NJTKUHMHJLEUQT-GUBAARJWSA-N |
| XLogP | 5.26 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.64 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|