C24H27NO6 — CID 157314005
(5-benzoyloxy-6-ethanimidoyloxy-3,4-dimethyloxan-2-yl)methyl benzoate (PubChem CID 157314005) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is (5-benzoyloxy-6-ethanimidoyloxy-3,4-dimethyloxan-2-yl)methyl benzoate.
| Compound Name | (5-benzoyloxy-6-ethanimidoyloxy-3,4-dimethyloxan-2-yl)methyl benzoate |
|---|---|
| PubChem CID | 157314005 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | (5-benzoyloxy-6-ethanimidoyloxy-3,4-dimethyloxan-2-yl)methyl benzoate |
| SMILES | [H]/N=C(\C)OC1OC(COC(=O)c2ccccc2)C(C)C(C)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H27NO6/c1-15-16(2)21(31-23(27)19-12-8-5-9-13-19)24(29-17(3)25)30-20(15)14-28-22(26)18-10-6-4-7-11-18/h4-13,15-16,20-21,24-25H,14H2,1-3H3/b25-17+ |
| InChIKey | RZLKCCDJOJHTRT-KOEQRZSOSA-N |
| XLogP | 4.08 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|