C19H27NO5 — CID 58435431
[2-ethanimidoyloxy-4,5-dimethyl-6-(phenylmethoxymethyl)oxan-3-yl] acetate (PubChem CID 58435431) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is [2-ethanimidoyloxy-4,5-dimethyl-6-(phenylmethoxymethyl)oxan-3-yl] acetate.
| Compound Name | [2-ethanimidoyloxy-4,5-dimethyl-6-(phenylmethoxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 58435431 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | [2-ethanimidoyloxy-4,5-dimethyl-6-(phenylmethoxymethyl)oxan-3-yl] acetate |
| SMILES | [H]/N=C(\C)OC1OC(COCc2ccccc2)C(C)C(C)C1OC(C)=O |
| InChI | InChI=1S/C19H27NO5/c1-12-13(2)18(24-15(4)21)19(23-14(3)20)25-17(12)11-22-10-16-8-6-5-7-9-16/h5-9,12-13,17-20H,10-11H2,1-4H3/b20-14+ |
| InChIKey | QUEKKGJJKUYKNC-XSFVSMFZSA-N |
| XLogP | 3.15 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|