C18H24O6 — CID 58326011
[6-acetyloxy-3-methyl-2-(phenylmethoxymethyl)oxan-4-yl] acetate (PubChem CID 58326011) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is [6-acetyloxy-3-methyl-2-(phenylmethoxymethyl)oxan-4-yl] acetate.
| Compound Name | [6-acetyloxy-3-methyl-2-(phenylmethoxymethyl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 58326011 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | [6-acetyloxy-3-methyl-2-(phenylmethoxymethyl)oxan-4-yl] acetate |
| SMILES | CC(=O)OC1CC(OC(C)=O)C(C)C(COCc2ccccc2)O1 |
| InChI | InChI=1S/C18H24O6/c1-12-16(22-13(2)19)9-18(23-14(3)20)24-17(12)11-21-10-15-7-5-4-6-8-15/h4-8,12,16-18H,9-11H2,1-3H3 |
| InChIKey | QUKISQZQWLVQQL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |