C28H28O6 — CID 102461653
[(2R,3S)-5-acetyloxy-2-(trityloxymethyl)oxolan-3-yl] acetate (PubChem CID 102461653) has the molecular formula C28H28O6 and a molecular weight of 460.53 g/mol. Its IUPAC name is [(2R,3S)-5-acetyloxy-2-(trityloxymethyl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3S)-5-acetyloxy-2-(trityloxymethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 102461653 |
| Molecular Formula | C28H28O6 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | [(2R,3S)-5-acetyloxy-2-(trityloxymethyl)oxolan-3-yl] acetate |
| SMILES | CC(=O)OC1C[C@H](OC(C)=O)[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C28H28O6/c1-20(29)32-25-18-27(33-21(2)30)34-26(25)19-31-28(22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-17,25-27H,18-19H2,1-2H3/t25-,26+,27?/m0/s1 |
| InChIKey | UHWMILGSFXVJHM-AJRFNQODSA-N |
| XLogP | 4.60 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|