C15H22O3 — CID 159970118
(4R,5R)-4,5-dimethyl-6-(phenylmethoxymethyl)oxan-2-ol (PubChem CID 159970118) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (4R,5R)-4,5-dimethyl-6-(phenylmethoxymethyl)oxan-2-ol.
| Compound Name | (4R,5R)-4,5-dimethyl-6-(phenylmethoxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 159970118 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (4R,5R)-4,5-dimethyl-6-(phenylmethoxymethyl)oxan-2-ol |
| SMILES | C[C@@H]1CC(O)OC(COCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C15H22O3/c1-11-8-15(16)18-14(12(11)2)10-17-9-13-6-4-3-5-7-13/h3-7,11-12,14-16H,8-10H2,1-2H3/t11-,12-,14?,15?/m1/s1 |
| InChIKey | WUPWTRKCKQAMLH-HGWMRPEMSA-N |
| XLogP | 2.58 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |