C18H28O3 — CID 167640329
(2S,4S,5S)-4-ethyl-2-methoxy-3,5-dimethyl-6-(phenylmethoxymethyl)oxane (PubChem CID 167640329) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is (2S,4S,5S)-4-ethyl-2-methoxy-3,5-dimethyl-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2S,4S,5S)-4-ethyl-2-methoxy-3,5-dimethyl-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 167640329 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (2S,4S,5S)-4-ethyl-2-methoxy-3,5-dimethyl-6-(phenylmethoxymethyl)oxane |
| SMILES | CC[C@@H]1C(C)[C@@H](OC)OC(COCc2ccccc2)[C@H]1C |
| InChI | InChI=1S/C18H28O3/c1-5-16-13(2)17(21-18(19-4)14(16)3)12-20-11-15-9-7-6-8-10-15/h6-10,13-14,16-18H,5,11-12H2,1-4H3/t13-,14?,16-,17?,18-/m0/s1 |
| InChIKey | OAMJQEGUEMKBLR-QBRIDXRCSA-N |
| XLogP | 3.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |