C28H48O6Si — CID 167608349
[(2R,3R,5S)-6-ethyl-2-[(3S,4R,6S)-6-methoxy-4,5-dimethyl-2-(phenylmethoxymethyl)oxan-3-yl]oxy-4,5-dimethyloxan-3-yl]oxy-trimethylsilane (PubChem CID 167608349) has the molecular formula C28H48O6Si and a molecular weight of 508.77 g/mol. Its IUPAC name is [(2R,3R,5S)-6-ethyl-2-[(3S,4R,6S)-6-methoxy-4,5-dimethyl-2-(phenylmethoxymethyl)oxan-3-yl]oxy-4,5-dimethyloxan-3-yl]oxy-trimethylsilane.
| Compound Name | [(2R,3R,5S)-6-ethyl-2-[(3S,4R,6S)-6-methoxy-4,5-dimethyl-2-(phenylmethoxymethyl)oxan-3-yl]oxy-4,5-dimethyloxan-3-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 167608349 |
| Molecular Formula | C28H48O6Si |
| Molecular Weight | 508.77 g/mol |
| Exact Mass | 508.32 |
| IUPAC Name | [(2R,3R,5S)-6-ethyl-2-[(3S,4R,6S)-6-methoxy-4,5-dimethyl-2-(phenylmethoxymethyl)oxan-3-yl]oxy-4,5-dimethyloxan-3-yl]oxy-trimethylsilane |
| SMILES | CCC1O[C@H](O[C@@H]2C(COCc3ccccc3)O[C@H](OC)C(C)[C@H]2C)[C@H](O[Si](C)(C)C)C(C)[C@@H]1C |
| InChI | InChI=1S/C28H48O6Si/c1-10-23-18(2)19(3)26(34-35(7,8)9)28(31-23)33-25-20(4)21(5)27(29-6)32-24(25)17-30-16-22-14-12-11-13-15-22/h11-15,18-21,23-28H,10,16-17H2,1-9H3/t18-,19?,20+,21?,23?,24?,25-,26+,27-,28+/m0/s1 |
| InChIKey | KRPZREJZJNBJRB-TVDWJWCISA-N |
| XLogP | 5.86 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.77 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|