C21H24O5 — CID 134832463
(2S,5R)-2-methoxy-5-phenylmethoxy-4-(phenylmethoxymethyl)-3,7-dioxabicyclo[4.1.0]heptane (PubChem CID 134832463) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is (2S,5R)-2-methoxy-5-phenylmethoxy-4-(phenylmethoxymethyl)-3,7-dioxabicyclo[4.1.0]heptane.
| Compound Name | (2S,5R)-2-methoxy-5-phenylmethoxy-4-(phenylmethoxymethyl)-3,7-dioxabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 134832463 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (2S,5R)-2-methoxy-5-phenylmethoxy-4-(phenylmethoxymethyl)-3,7-dioxabicyclo[4.1.0]heptane |
| SMILES | CO[C@H]1OC(COCc2ccccc2)[C@@H](OCc2ccccc2)C2OC21 |
| InChI | InChI=1S/C21H24O5/c1-22-21-20-19(26-20)18(24-13-16-10-6-3-7-11-16)17(25-21)14-23-12-15-8-4-2-5-9-15/h2-11,17-21H,12-14H2,1H3/t17?,18-,19?,20?,21+/m1/s1 |
| InChIKey | GBKGLTGBXHATDY-KQNAIQNQSA-N |
| XLogP | 2.93 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|