C36H46O6 — CID 174093632
(2R,4R,5S)-5-[(2S,5S)-5,6-dimethyl-3-phenylmethoxyoxan-2-yl]oxy-3,4-dimethyl-2-phenylmethoxy-6-(phenylmethoxymethyl)oxane (PubChem CID 174093632) has the molecular formula C36H46O6 and a molecular weight of 574.76 g/mol. Its IUPAC name is (2R,4R,5S)-5-[(2S,5S)-5,6-dimethyl-3-phenylmethoxyoxan-2-yl]oxy-3,4-dimethyl-2-phenylmethoxy-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2R,4R,5S)-5-[(2S,5S)-5,6-dimethyl-3-phenylmethoxyoxan-2-yl]oxy-3,4-dimethyl-2-phenylmethoxy-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 174093632 |
| Molecular Formula | C36H46O6 |
| Molecular Weight | 574.76 g/mol |
| Exact Mass | 574.33 |
| IUPAC Name | (2R,4R,5S)-5-[(2S,5S)-5,6-dimethyl-3-phenylmethoxyoxan-2-yl]oxy-3,4-dimethyl-2-phenylmethoxy-6-(phenylmethoxymethyl)oxane |
| SMILES | CC1[C@H](OCc2ccccc2)OC(COCc2ccccc2)[C@@H](O[C@@H]2OC(C)[C@@H](C)CC2OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C36H46O6/c1-25-20-32(38-22-30-16-10-6-11-17-30)36(40-28(25)4)42-34-26(2)27(3)35(39-23-31-18-12-7-13-19-31)41-33(34)24-37-21-29-14-8-5-9-15-29/h5-19,25-28,32-36H,20-24H2,1-4H3/t25-,26+,27?,28?,32?,33?,34-,35+,36-/m0/s1 |
| InChIKey | VVNYKHYSGCKXRQ-VZWJCMCOSA-N |
| XLogP | 7.16 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.76 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |