C31H28Cl3NO9 — CID 11585555
[(2R,3R,4S,5S,6R)-5-acetyloxy-4-benzoyloxy-2-(phenylmethoxymethyl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate (PubChem CID 11585555) has the molecular formula C31H28Cl3NO9 and a molecular weight of 664.92 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-5-acetyloxy-4-benzoyloxy-2-(phenylmethoxymethyl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,5S,6R)-5-acetyloxy-4-benzoyloxy-2-(phenylmethoxymethyl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 11585555 |
| Molecular Formula | C31H28Cl3NO9 |
| Molecular Weight | 664.92 g/mol |
| Exact Mass | 663.08 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-5-acetyloxy-4-benzoyloxy-2-(phenylmethoxymethyl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate |
| SMILES | [H]/N=C(/O[C@H]1O[C@H](COCc2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@@H]1OC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C31H28Cl3NO9/c1-19(36)40-26-25(43-28(38)22-15-9-4-10-16-22)24(42-27(37)21-13-7-3-8-14-21)23(18-39-17-20-11-5-2-6-12-20)41-29(26)44-30(35)31(32,33)34/h2-16,23-26,29,35H,17-18H2,1H3/b35-30+/t23-,24-,25+,26+,29-/m1/s1 |
| InChIKey | BBRONCFLAUBEAI-AWFSJPDHSA-N |
| XLogP | 5.68 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.92 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|