C24H25Cl3N4O6 — CID 102371532
[(2R,3S,4R,5R,6S)-5-azido-4-phenylmethoxy-2-(phenylmethoxymethyl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate (PubChem CID 102371532) has the molecular formula C24H25Cl3N4O6 and a molecular weight of 571.85 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-azido-4-phenylmethoxy-2-(phenylmethoxymethyl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-azido-4-phenylmethoxy-2-(phenylmethoxymethyl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 102371532 |
| Molecular Formula | C24H25Cl3N4O6 |
| Molecular Weight | 571.85 g/mol |
| Exact Mass | 570.08 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-azido-4-phenylmethoxy-2-(phenylmethoxymethyl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] acetate |
| SMILES | [H]/N=C(/O[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OC(C)=O)[C@H](OCc2ccccc2)[C@H]1N=[N+]=[N-])C(Cl)(Cl)Cl |
| InChI | InChI=1S/C24H25Cl3N4O6/c1-15(32)35-20-18(14-33-12-16-8-4-2-5-9-16)36-22(37-23(28)24(25,26)27)19(30-31-29)21(20)34-13-17-10-6-3-7-11-17/h2-11,18-22,28H,12-14H2,1H3/b28-23+/t18-,19-,20-,21-,22+/m1/s1 |
| InChIKey | JEDGRTAQKBJJMW-KDPYJRQQSA-N |
| XLogP | 5.49 |
| TPSA | 135.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.85 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|