C29H28Cl3N3O6 — CID 146030564
[(4R,5R)-3-azido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] 2,2,2-trichloroacetate (PubChem CID 146030564) has the molecular formula C29H28Cl3N3O6 and a molecular weight of 620.92 g/mol. Its IUPAC name is [(4R,5R)-3-azido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] 2,2,2-trichloroacetate.
| Compound Name | [(4R,5R)-3-azido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 146030564 |
| Molecular Formula | C29H28Cl3N3O6 |
| Molecular Weight | 620.92 g/mol |
| Exact Mass | 619.10 |
| IUPAC Name | [(4R,5R)-3-azido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] 2,2,2-trichloroacetate |
| SMILES | [N-]=[N+]=NC1C(OC(=O)C(Cl)(Cl)Cl)OC(COCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C29H28Cl3N3O6/c30-29(31,32)28(36)41-27-24(34-35-33)26(39-18-22-14-8-3-9-15-22)25(38-17-21-12-6-2-7-13-21)23(40-27)19-37-16-20-10-4-1-5-11-20/h1-15,23-27H,16-19H2/t23?,24?,25-,26+,27?/m0/s1 |
| InChIKey | WNMZGYOIQUDJET-LRIXJPIBSA-N |
| XLogP | 6.69 |
| TPSA | 111.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.92 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|