C31H40N5O6P — CID 101218560
N-[[(2S,3R,4R,5S,6R)-3-azido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-(dimethylamino)phosphoryl]-N-methylmethanamine (PubChem CID 101218560) has the molecular formula C31H40N5O6P and a molecular weight of 609.66 g/mol. Its IUPAC name is N-[[(2S,3R,4R,5S,6R)-3-azido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-(dimethylamino)phosphoryl]-N-methylmethanamine.
| Compound Name | N-[[(2S,3R,4R,5S,6R)-3-azido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-(dimethylamino)phosphoryl]-N-methylmethanamine |
|---|---|
| PubChem CID | 101218560 |
| Molecular Formula | C31H40N5O6P |
| Molecular Weight | 609.66 g/mol |
| Exact Mass | 609.27 |
| IUPAC Name | N-[[(2S,3R,4R,5S,6R)-3-azido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-(dimethylamino)phosphoryl]-N-methylmethanamine |
| SMILES | CN(C)P(=O)(O[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1N=[N+]=[N-])N(C)C |
| InChI | InChI=1S/C31H40N5O6P/c1-35(2)43(37,36(3)4)42-31-28(33-34-32)30(40-22-26-18-12-7-13-19-26)29(39-21-25-16-10-6-11-17-25)27(41-31)23-38-20-24-14-8-5-9-15-24/h5-19,27-31H,20-23H2,1-4H3/t27-,28-,29-,30-,31+/m1/s1 |
| InChIKey | SPBYTEFVGDTWNV-CWMPKMHISA-N |
| XLogP | 6.03 |
| TPSA | 118.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.66 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|