C31H33N3O7 — CID 10951852
[(3R,4R,5R,6R)-3-azido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] prop-1-en-2-yl carbonate (PubChem CID 10951852) has the molecular formula C31H33N3O7 and a molecular weight of 559.62 g/mol. Its IUPAC name is [(3R,4R,5R,6R)-3-azido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] prop-1-en-2-yl carbonate.
| Compound Name | [(3R,4R,5R,6R)-3-azido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] prop-1-en-2-yl carbonate |
|---|---|
| PubChem CID | 10951852 |
| Molecular Formula | C31H33N3O7 |
| Molecular Weight | 559.62 g/mol |
| Exact Mass | 559.23 |
| IUPAC Name | [(3R,4R,5R,6R)-3-azido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] prop-1-en-2-yl carbonate |
| SMILES | C=C(C)OC(=O)OC1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C31H33N3O7/c1-22(2)39-31(35)41-30-27(33-34-32)29(38-20-25-16-10-5-11-17-25)28(37-19-24-14-8-4-9-15-24)26(40-30)21-36-18-23-12-6-3-7-13-23/h3-17,26-30H,1,18-21H2,2H3/t26-,27-,28+,29-,30?/m1/s1 |
| InChIKey | VOJCBDHHYPZEPA-MPUKMYDRSA-N |
| XLogP | 6.46 |
| TPSA | 121.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.62 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|