C31H35N3O5 — CID 101090917
(2R,3R,4R,5R,6R)-3-azido-2-[(2S)-but-3-en-2-yl]oxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 101090917) has the molecular formula C31H35N3O5 and a molecular weight of 529.64 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-3-azido-2-[(2S)-but-3-en-2-yl]oxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2R,3R,4R,5R,6R)-3-azido-2-[(2S)-but-3-en-2-yl]oxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 101090917 |
| Molecular Formula | C31H35N3O5 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | (2R,3R,4R,5R,6R)-3-azido-2-[(2S)-but-3-en-2-yl]oxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | C=C[C@H](C)O[C@@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C31H35N3O5/c1-3-23(2)38-31-28(33-34-32)30(37-21-26-17-11-6-12-18-26)29(36-20-25-15-9-5-10-16-25)27(39-31)22-35-19-24-13-7-4-8-14-24/h3-18,23,27-31H,1,19-22H2,2H3/t23-,27+,28+,29-,30+,31+/m0/s1 |
| InChIKey | VXRYESUWMUXKFH-OLIOGDFWSA-N |
| XLogP | 6.37 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|